C7H10N4O3S — CID 2787152
methyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]propanoate (PubChem CID 2787152) has the molecular formula C7H10N4O3S and a molecular weight of 230.25 g/mol. Its IUPAC name is methyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]propanoate.
| Compound Name | methyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]propanoate |
|---|---|
| PubChem CID | 2787152 |
| Molecular Formula | C7H10N4O3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | methyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]propanoate |
| SMILES | COC(=O)C(C)Nc1n[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C7H10N4O3S/c1-3(6(13)14-2)8-4-5(12)9-7(15)11-10-4/h3H,1-2H3,(H,8,10)(H2,9,11,12,15) |
| InChIKey | LFMGWEOWDALJJD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|