About N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide (PubChem CID 27874591) has the molecular formula C22H24N4O3S
and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide.
Molecular Properties
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide |
| PubChem CID | 27874591 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide |
| SMILES | CCCN(C(=O)CSc1ccccc1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H24N4O3S/c1-2-13-25(18(27)15-30-17-11-7-4-8-12-17)19-20(23)26(22(29)24-21(19)28)14-16-9-5-3-6-10-16/h3-12H,2,13-15,23H2,1H3,(H,24,28,29) |
| InChIKey | IDIMZAQXYSTSJJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide?
The IUPAC name of N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide (CID 27874591) is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide.
What is the SMILES notation for N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide?
The canonical SMILES for N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide is CCCN(C(=O)CSc1ccccc1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide?
The InChIKey is IDIMZAQXYSTSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O3S/c1-2-13-25(18(27)15-30-17-11-7-4-8-12-17)19-20(23)26(22(29)24-21(19)28)14-16-9-5-3-6-10-16/h3-12H,2,13-15,23H2,1H3,(H,24,28,29).
What are the key properties of N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide?
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide has a molecular weight of 424.53 g/mol, XLogP of 2.70, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-phenylsulfanyl-N-propylacetamide is sourced from PubChem (CID 27874591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).