C22H16BrN3O3 — CID 27876772
2-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-phenylbenzamide (PubChem CID 27876772) has the molecular formula C22H16BrN3O3 and a molecular weight of 450.29 g/mol. Its IUPAC name is 2-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-phenylbenzamide.
| Compound Name | 2-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 27876772 |
| Molecular Formula | C22H16BrN3O3 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 2-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1OCc1nc(-c2cccc(Br)c2)no1 |
| InChI | InChI=1S/C22H16BrN3O3/c23-16-8-6-7-15(13-16)21-25-20(29-26-21)14-28-19-12-5-4-11-18(19)22(27)24-17-9-2-1-3-10-17/h1-13H,14H2,(H,24,27) |
| InChIKey | JJDLTCCRIKBOGB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |