4-phenylpentanoic acid

C11H14O2 — CID 27877

IUPAC4-phenylpentanoic acid
SMILESCC(CCC(=O)O)c1ccccc1
InChIInChI=1S/C11H14O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13)
InChIKeyUIIMQLPOAXFKFW-UHFFFAOYSA-N
MW178.23 g/mol
LogP2.65
Rot. Bonds4

About 4-phenylpentanoic acid

4-phenylpentanoic acid (PubChem CID 27877) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-phenylpentanoic acid.

Molecular Properties

Compound Name4-phenylpentanoic acid
PubChem CID27877
Molecular FormulaC11H14O2
Molecular Weight178.23 g/mol
Exact Mass178.10
IUPAC Name4-phenylpentanoic acid
SMILESCC(CCC(=O)O)c1ccccc1
InChIInChI=1S/C11H14O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13)
InChIKeyUIIMQLPOAXFKFW-UHFFFAOYSA-N
XLogP2.65
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.23
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-phenylpentanoic acid?
The IUPAC name of 4-phenylpentanoic acid (CID 27877) is 4-phenylpentanoic acid.
What is the SMILES notation for 4-phenylpentanoic acid?
The canonical SMILES for 4-phenylpentanoic acid is CC(CCC(=O)O)c1ccccc1.
What is the InChIKey of 4-phenylpentanoic acid?
The InChIKey is UIIMQLPOAXFKFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13).
What are the key properties of 4-phenylpentanoic acid?
4-phenylpentanoic acid has a molecular weight of 178.23 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpentanoic acid is sourced from PubChem (CID 27877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).