About azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate
azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate (PubChem CID 2787711) has the molecular formula C29H38N2O5
and a molecular weight of 494.63 g/mol. Its IUPAC name is azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate.
Molecular Properties
| Compound Name | azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate |
| PubChem CID | 2787711 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate |
| SMILES | C1CCC[NH2+]CC1.COc1ccc(Oc2coc3c(CN4CCCCCC4)c([O-])ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H25NO5.C6H13N/c1-27-16-6-8-17(9-7-16)29-21-15-28-23-18(22(21)26)10-11-20(25)19(23)14-24-12-4-2-3-5-13-24;1-2-4-6-7-5-3-1/h6-11,15,25H,2-5,12-14H2,1H3;7H,1-6H2 |
| InChIKey | AOEVUVJYJWDSHR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate?
The IUPAC name of azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate (CID 2787711) is azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate.
What is the SMILES notation for azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate?
The canonical SMILES for azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate is C1CCC[NH2+]CC1.COc1ccc(Oc2coc3c(CN4CCCCCC4)c([O-])ccc3c2=O)cc1.
What is the InChIKey of azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate?
The InChIKey is AOEVUVJYJWDSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO5.C6H13N/c1-27-16-6-8-17(9-7-16)29-21-15-28-23-18(22(21)26)10-11-20(25)19(23)14-24-12-4-2-3-5-13-24;1-2-4-6-7-5-3-1/h6-11,15,25H,2-5,12-14H2,1H3;7H,1-6H2.
What are the key properties of azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate?
azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate has a molecular weight of 494.63 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-ium;8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate is sourced from PubChem (CID 2787711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).