C18H13FN4O3S — CID 27877180
N-[(Z)-[(5R)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-fluorobenzamide (PubChem CID 27877180) has the molecular formula C18H13FN4O3S and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[(Z)-[(5R)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-fluorobenzamide.
| Compound Name | N-[(Z)-[(5R)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 27877180 |
| Molecular Formula | C18H13FN4O3S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-[(Z)-[(5R)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-fluorobenzamide |
| SMILES | O=C(N/N=C\[C@@H]1C(=O)NC(=S)N(c2ccccc2)C1=O)c1ccccc1F |
| InChI | InChI=1S/C18H13FN4O3S/c19-14-9-5-4-8-12(14)16(25)22-20-10-13-15(24)21-18(27)23(17(13)26)11-6-2-1-3-7-11/h1-10,13H,(H,22,25)(H,21,24,27)/b20-10-/t13-/m1/s1 |
| InChIKey | HBOWGNACUCMUPJ-CFFVULROSA-N |
| XLogP | 1.61 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|