C26H20N2O3S — CID 27878003
(6R,9S)-6-(4-oxochromen-3-yl)-9-thiophen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 27878003) has the molecular formula C26H20N2O3S and a molecular weight of 440.52 g/mol. Its IUPAC name is (6R,9S)-6-(4-oxochromen-3-yl)-9-thiophen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-6-(4-oxochromen-3-yl)-9-thiophen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 27878003 |
| Molecular Formula | C26H20N2O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (6R,9S)-6-(4-oxochromen-3-yl)-9-thiophen-2-yl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1C[C@@H](c2cccs2)CC2=C1[C@H](c1coc3ccccc3c1=O)Nc1ccccc1N2 |
| InChI | InChI=1S/C26H20N2O3S/c29-21-13-15(23-10-5-11-32-23)12-20-24(21)25(28-19-8-3-2-7-18(19)27-20)17-14-31-22-9-4-1-6-16(22)26(17)30/h1-11,14-15,25,27-28H,12-13H2/t15-,25-/m0/s1 |
| InChIKey | XMGNDLKGRYGTTB-MQNRADLISA-N |
| XLogP | 5.83 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |