C20H23N3O5 — CID 27878466
(4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 27878466) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 27878466 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | COc1cc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH][nH]c(=O)c32)cc(OC)c1O |
| InChI | InChI=1S/C20H23N3O5/c1-20(2)7-10-15(11(24)8-20)14(16-18(21-10)22-23-19(16)26)9-5-12(27-3)17(25)13(6-9)28-4/h5-6,14,25H,7-8H2,1-4H3,(H3,21,22,23,26)/t14-/m1/s1 |
| InChIKey | RSGKMRLTZGPSRN-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |