C21H20FNO3 — CID 27881721
(9R)-9-(3-fluorophenyl)-6,8-dimethoxy-3,4,9,10-tetrahydro-2H-acridin-1-one (PubChem CID 27881721) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is (9R)-9-(3-fluorophenyl)-6,8-dimethoxy-3,4,9,10-tetrahydro-2H-acridin-1-one.
| Compound Name | (9R)-9-(3-fluorophenyl)-6,8-dimethoxy-3,4,9,10-tetrahydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 27881721 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (9R)-9-(3-fluorophenyl)-6,8-dimethoxy-3,4,9,10-tetrahydro-2H-acridin-1-one |
| SMILES | COc1cc2c(c(OC)c1)[C@@H](c1cccc(F)c1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C21H20FNO3/c1-25-14-10-16-21(18(11-14)26-2)19(12-5-3-6-13(22)9-12)20-15(23-16)7-4-8-17(20)24/h3,5-6,9-11,19,23H,4,7-8H2,1-2H3/t19-/m0/s1 |
| InChIKey | PRYANPJREGJBNM-IBGZPJMESA-N |
| XLogP | 4.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |