About N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide
N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 2788365) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| PubChem CID | 2788365 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C17H17NO3/c1-2-12-7-3-4-8-13(12)18-17(19)16-11-20-14-9-5-6-10-15(14)21-16/h3-10,16H,2,11H2,1H3,(H,18,19) |
| InChIKey | OXTFYZVSHLJBLB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
The IUPAC name of N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (CID 2788365) is N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
What is the SMILES notation for N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
The canonical SMILES for N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide is CCc1ccccc1NC(=O)C1COc2ccccc2O1.
What is the InChIKey of N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
The InChIKey is OXTFYZVSHLJBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-2-12-7-3-4-8-13(12)18-17(19)16-11-20-14-9-5-6-10-15(14)21-16/h3-10,16H,2,11H2,1H3,(H,18,19).
What are the key properties of N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide?
N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide has a molecular weight of 283.33 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylphenyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide is sourced from PubChem (CID 2788365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).