About 3-benzyl-1,3-thiazolidine-2,4-dione
3-benzyl-1,3-thiazolidine-2,4-dione (PubChem CID 2788476) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-benzyl-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-benzyl-1,3-thiazolidine-2,4-dione |
| PubChem CID | 2788476 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-benzyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C10H9NO2S/c12-9-7-14-10(13)11(9)6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | JIMXJAFZPUUCAD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,3-thiazolidine-2,4-dione?
The IUPAC name of 3-benzyl-1,3-thiazolidine-2,4-dione (CID 2788476) is 3-benzyl-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for 3-benzyl-1,3-thiazolidine-2,4-dione?
The canonical SMILES for 3-benzyl-1,3-thiazolidine-2,4-dione is O=C1CSC(=O)N1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1,3-thiazolidine-2,4-dione?
The InChIKey is JIMXJAFZPUUCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c12-9-7-14-10(13)11(9)6-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 3-benzyl-1,3-thiazolidine-2,4-dione?
3-benzyl-1,3-thiazolidine-2,4-dione has a molecular weight of 207.25 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 2788476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).