C16H18N2O3S2 — CID 2788704
methyl 6-[4-oxo-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 2788704) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 6-[4-oxo-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | methyl 6-[4-oxo-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 2788704 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | methyl 6-[4-oxo-5-(pyridin-4-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | COC(=O)CCCCCN1C(=O)C(=Cc2ccncc2)SC1=S |
| InChI | InChI=1S/C16H18N2O3S2/c1-21-14(19)5-3-2-4-10-18-15(20)13(23-16(18)22)11-12-6-8-17-9-7-12/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | YPSBXHGMVCKHNO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|