C21H15Cl2NO4 — CID 2788847
2-(2,4-dichlorophenoxy)-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 2788847) has the molecular formula C21H15Cl2NO4 and a molecular weight of 416.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 2788847 |
| Molecular Formula | C21H15Cl2NO4 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)COc1ccc(Cl)cc1Cl)oc1ccccc12 |
| InChI | InChI=1S/C21H15Cl2NO4/c1-26-20-9-14-13-4-2-3-5-17(13)28-19(14)10-16(20)24-21(25)11-27-18-7-6-12(22)8-15(18)23/h2-10H,11H2,1H3,(H,24,25) |
| InChIKey | LVBIYCXDLJWKMQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |