C12H15N5O3 — CID 2788862
N-(cyclohex-3-en-1-ylmethylideneamino)-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide (PubChem CID 2788862) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethylideneamino)-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide.
| Compound Name | N-(cyclohex-3-en-1-ylmethylideneamino)-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide |
|---|---|
| PubChem CID | 2788862 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethylideneamino)-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)[nH]c1=O)NN=CC1CC=CCC1 |
| InChI | InChI=1S/C12H15N5O3/c18-10(6-9-11(19)14-12(20)17-15-9)16-13-7-8-4-2-1-3-5-8/h1-2,7-8H,3-6H2,(H,16,18)(H2,14,17,19,20) |
| InChIKey | OZJLAATUSFERIE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|