C26H23NO6 — CID 2789059
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 2789059) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 2789059 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)Oc1ccc2c3c(c(=O)oc2c1)CCC3)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H23NO6/c1-14(2)12-21(27-23(28)18-6-3-4-7-19(18)24(27)29)26(31)32-15-10-11-17-16-8-5-9-20(16)25(30)33-22(17)13-15/h3-4,6-7,10-11,13-14,21H,5,8-9,12H2,1-2H3 |
| InChIKey | JMDJNNYNLMQMOD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|