C24H27FN4O4 — CID 27890713
4-(4-fluoroanilino)-1-[(3S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide (PubChem CID 27890713) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is 4-(4-fluoroanilino)-1-[(3S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 4-(4-fluoroanilino)-1-[(3S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27890713 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-(4-fluoroanilino)-1-[(3S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C[C@H](N3CCC(Nc4ccc(F)cc4)(C(N)=O)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27FN4O4/c1-33-19-8-2-16(3-9-19)15-29-21(30)14-20(22(29)31)28-12-10-24(11-13-28,23(26)32)27-18-6-4-17(25)5-7-18/h2-9,20,27H,10-15H2,1H3,(H2,26,32)/t20-/m0/s1 |
| InChIKey | JFSVKUJFHINTCE-FQEVSTJZSA-N |
| XLogP | 1.89 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|