About oct-1-en-3-yl butanoate
oct-1-en-3-yl butanoate (PubChem CID 27892) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is oct-1-en-3-yl butanoate.
Molecular Properties
| Compound Name | oct-1-en-3-yl butanoate |
| PubChem CID | 27892 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | oct-1-en-3-yl butanoate |
| SMILES | C=CC(CCCCC)OC(=O)CCC |
| InChI | InChI=1S/C12H22O2/c1-4-7-8-10-11(6-3)14-12(13)9-5-2/h6,11H,3-5,7-10H2,1-2H3 |
| InChIKey | LZWFXVJBIZIHCH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-1-en-3-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-en-3-yl butanoate?
The IUPAC name of oct-1-en-3-yl butanoate (CID 27892) is oct-1-en-3-yl butanoate.
What is the SMILES notation for oct-1-en-3-yl butanoate?
The canonical SMILES for oct-1-en-3-yl butanoate is C=CC(CCCCC)OC(=O)CCC.
What is the InChIKey of oct-1-en-3-yl butanoate?
The InChIKey is LZWFXVJBIZIHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-7-8-10-11(6-3)14-12(13)9-5-2/h6,11H,3-5,7-10H2,1-2H3.
What are the key properties of oct-1-en-3-yl butanoate?
oct-1-en-3-yl butanoate has a molecular weight of 198.31 g/mol, XLogP of 3.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-en-3-yl butanoate is sourced from PubChem (CID 27892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).