C13H13Cl2NO5S — CID 2789251
dimethyl 2-[(2,2-dichloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate (PubChem CID 2789251) has the molecular formula C13H13Cl2NO5S and a molecular weight of 366.22 g/mol. Its IUPAC name is dimethyl 2-[(2,2-dichloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate.
| Compound Name | dimethyl 2-[(2,2-dichloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 2789251 |
| Molecular Formula | C13H13Cl2NO5S |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | dimethyl 2-[(2,2-dichloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(Cl)Cl)sc2c1C(C(=O)OC)CC2 |
| InChI | InChI=1S/C13H13Cl2NO5S/c1-20-12(18)5-3-4-6-7(5)8(13(19)21-2)11(22-6)16-10(17)9(14)15/h5,9H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | ZJMJTLFMPPKEKC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|