C21H22N4O3 — CID 27892984
N,N-diethyl-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]benzamide (PubChem CID 27892984) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N,N-diethyl-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 27892984 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N,N-diethyl-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)Cn2cnc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C21H22N4O3/c1-3-24(4-2)20(27)15-8-7-9-16(12-15)23-19(26)13-25-14-22-18-11-6-5-10-17(18)21(25)28/h5-12,14H,3-4,13H2,1-2H3,(H,23,26) |
| InChIKey | YTVNUMKEYZCYFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |