C18H19BrClNO5 — CID 27893473
2-(4-bromo-2-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 27893473) has the molecular formula C18H19BrClNO5 and a molecular weight of 444.71 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27893473 |
| Molecular Formula | C18H19BrClNO5 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)COc2ccc(Br)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H19BrClNO5/c1-23-15-6-11(7-16(24-2)18(15)25-3)9-21-17(22)10-26-14-5-4-12(19)8-13(14)20/h4-8H,9-10H2,1-3H3,(H,21,22) |
| InChIKey | IKPHSXHCSGFLAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |