About N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride
N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride (PubChem CID 2789485) has the molecular formula C18H20ClN3
and a molecular weight of 313.83 g/mol. Its IUPAC name is N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride |
| PubChem CID | 2789485 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride |
| SMILES | CCN(CC)c1nc(-c2ccccc2)nc2ccccc12.Cl |
| InChI | InChI=1S/C18H19N3.ClH/c1-3-21(4-2)18-15-12-8-9-13-16(15)19-17(20-18)14-10-6-5-7-11-14;/h5-13H,3-4H2,1-2H3;1H |
| InChIKey | UCDVRLYVPHGCTR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride?
The IUPAC name of N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride (CID 2789485) is N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride.
What is the SMILES notation for N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride?
The canonical SMILES for N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride is CCN(CC)c1nc(-c2ccccc2)nc2ccccc12.Cl.
What is the InChIKey of N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride?
The InChIKey is UCDVRLYVPHGCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3.ClH/c1-3-21(4-2)18-15-12-8-9-13-16(15)19-17(20-18)14-10-6-5-7-11-14;/h5-13H,3-4H2,1-2H3;1H.
What are the key properties of N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride?
N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride has a molecular weight of 313.83 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-phenylquinazolin-4-amine;hydrochloride is sourced from PubChem (CID 2789485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).