About propyl 3-(2,2-dimethylpropanoylamino)benzoate
propyl 3-(2,2-dimethylpropanoylamino)benzoate (PubChem CID 2789634) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is propyl 3-(2,2-dimethylpropanoylamino)benzoate.
Molecular Properties
| Compound Name | propyl 3-(2,2-dimethylpropanoylamino)benzoate |
| PubChem CID | 2789634 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | propyl 3-(2,2-dimethylpropanoylamino)benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H21NO3/c1-5-9-19-13(17)11-7-6-8-12(10-11)16-14(18)15(2,3)4/h6-8,10H,5,9H2,1-4H3,(H,16,18) |
| InChIKey | PARZZEMXIWETSF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 3-(2,2-dimethylpropanoylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-(2,2-dimethylpropanoylamino)benzoate?
The IUPAC name of propyl 3-(2,2-dimethylpropanoylamino)benzoate (CID 2789634) is propyl 3-(2,2-dimethylpropanoylamino)benzoate.
What is the SMILES notation for propyl 3-(2,2-dimethylpropanoylamino)benzoate?
The canonical SMILES for propyl 3-(2,2-dimethylpropanoylamino)benzoate is CCCOC(=O)c1cccc(NC(=O)C(C)(C)C)c1.
What is the InChIKey of propyl 3-(2,2-dimethylpropanoylamino)benzoate?
The InChIKey is PARZZEMXIWETSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-5-9-19-13(17)11-7-6-8-12(10-11)16-14(18)15(2,3)4/h6-8,10H,5,9H2,1-4H3,(H,16,18).
What are the key properties of propyl 3-(2,2-dimethylpropanoylamino)benzoate?
propyl 3-(2,2-dimethylpropanoylamino)benzoate has a molecular weight of 263.34 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-(2,2-dimethylpropanoylamino)benzoate is sourced from PubChem (CID 2789634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).