C15H23ClN4 — CID 2789697
N',N'-diethyl-N-quinazolin-4-ylpropane-1,3-diamine;hydrochloride (PubChem CID 2789697) has the molecular formula C15H23ClN4 and a molecular weight of 294.83 g/mol. Its IUPAC name is N',N'-diethyl-N-quinazolin-4-ylpropane-1,3-diamine;hydrochloride.
| Compound Name | N',N'-diethyl-N-quinazolin-4-ylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 2789697 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N',N'-diethyl-N-quinazolin-4-ylpropane-1,3-diamine;hydrochloride |
| SMILES | CCN(CC)CCCNc1ncnc2ccccc12.Cl |
| InChI | InChI=1S/C15H22N4.ClH/c1-3-19(4-2)11-7-10-16-15-13-8-5-6-9-14(13)17-12-18-15;/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,16,17,18);1H |
| InChIKey | WBTLNIJNJSFDTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|