About methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride
methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride (PubChem CID 2789795) has the molecular formula C19H19ClN2O2
and a molecular weight of 342.83 g/mol. Its IUPAC name is methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride |
| PubChem CID | 2789795 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(Nc2cc(C)nc3ccc(C)cc23)cc1.Cl |
| InChI | InChI=1S/C19H18N2O2.ClH/c1-12-4-9-17-16(10-12)18(11-13(2)20-17)21-15-7-5-14(6-8-15)19(22)23-3;/h4-11H,1-3H3,(H,20,21);1H |
| InChIKey | RDBVEEHNZJLQDP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride?
The IUPAC name of methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride (CID 2789795) is methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride.
What is the SMILES notation for methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride?
The canonical SMILES for methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride is COC(=O)c1ccc(Nc2cc(C)nc3ccc(C)cc23)cc1.Cl.
What is the InChIKey of methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride?
The InChIKey is RDBVEEHNZJLQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2.ClH/c1-12-4-9-17-16(10-12)18(11-13(2)20-17)21-15-7-5-14(6-8-15)19(22)23-3;/h4-11H,1-3H3,(H,20,21);1H.
What are the key properties of methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride?
methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride has a molecular weight of 342.83 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,6-dimethylquinolin-4-yl)amino]benzoate;hydrochloride is sourced from PubChem (CID 2789795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).