About 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride
1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride (PubChem CID 2789802) has the molecular formula C19H19ClN2O
and a molecular weight of 326.83 g/mol. Its IUPAC name is 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride |
| PubChem CID | 2789802 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cccc(Nc2cc(C)nc3ccc(C)cc23)c1.Cl |
| InChI | InChI=1S/C19H18N2O.ClH/c1-12-7-8-18-17(9-12)19(10-13(2)20-18)21-16-6-4-5-15(11-16)14(3)22;/h4-11H,1-3H3,(H,20,21);1H |
| InChIKey | DKUQKLXFTOTLNF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride?
The IUPAC name of 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride (CID 2789802) is 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride.
What is the SMILES notation for 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride?
The canonical SMILES for 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride is CC(=O)c1cccc(Nc2cc(C)nc3ccc(C)cc23)c1.Cl.
What is the InChIKey of 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride?
The InChIKey is DKUQKLXFTOTLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O.ClH/c1-12-7-8-18-17(9-12)19(10-13(2)20-18)21-16-6-4-5-15(11-16)14(3)22;/h4-11H,1-3H3,(H,20,21);1H.
What are the key properties of 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride?
1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride has a molecular weight of 326.83 g/mol, XLogP of 5.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2,6-dimethylquinolin-4-yl)amino]phenyl]ethanone;hydrochloride is sourced from PubChem (CID 2789802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).