C21H25NO4S — CID 2789888
methyl 6-methyl-2-(4-phenoxybutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2789888) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is methyl 6-methyl-2-(4-phenoxybutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-methyl-2-(4-phenoxybutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2789888 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl 6-methyl-2-(4-phenoxybutanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCOc2ccccc2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C21H25NO4S/c1-14-10-11-16-17(13-14)27-20(19(16)21(24)25-2)22-18(23)9-6-12-26-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-13H2,1-2H3,(H,22,23) |
| InChIKey | VSRHSJGGPVQTGJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|