C24H24N2O7 — CID 2789923
dimethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzene-1,4-dicarboxylate (PubChem CID 2789923) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is dimethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 2789923 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | dimethyl 2-[[2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(CC(C)C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H24N2O7/c1-13(2)11-19(26-21(28)15-7-5-6-8-16(15)22(26)29)20(27)25-18-12-14(23(30)32-3)9-10-17(18)24(31)33-4/h5-10,12-13,19H,11H2,1-4H3,(H,25,27) |
| InChIKey | IKZNTQDWTRJNSM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|