About (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate
(4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate (PubChem CID 27910124) has the molecular formula C21H15N3O3S
and a molecular weight of 389.44 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate.
Molecular Properties
| Compound Name | (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate |
| PubChem CID | 27910124 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate |
| SMILES | Nc1nc(COC(=O)c2cc3c(s2)-c2ccccc2OC3)nc2ccccc12 |
| InChI | InChI=1S/C21H15N3O3S/c22-20-13-5-1-3-7-15(13)23-18(24-20)11-27-21(25)17-9-12-10-26-16-8-4-2-6-14(16)19(12)28-17/h1-9H,10-11H2,(H2,22,23,24) |
| InChIKey | FNURILWQOMDSBD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate?
The IUPAC name of (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate (CID 27910124) is (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate.
What is the SMILES notation for (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate?
The canonical SMILES for (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate is Nc1nc(COC(=O)c2cc3c(s2)-c2ccccc2OC3)nc2ccccc12.
What is the InChIKey of (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate?
The InChIKey is FNURILWQOMDSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O3S/c22-20-13-5-1-3-7-15(13)23-18(24-20)11-27-21(25)17-9-12-10-26-16-8-4-2-6-14(16)19(12)28-17/h1-9H,10-11H2,(H2,22,23,24).
What are the key properties of (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate?
(4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate has a molecular weight of 389.44 g/mol, XLogP of 4.19, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminoquinazolin-2-yl)methyl 4H-thieno[3,2-c]chromene-2-carboxylate is sourced from PubChem (CID 27910124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).