C20H25ClN4O — CID 2791333
N-[2-(4-methoxyphenyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride (PubChem CID 2791333) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-[2-(4-methoxyphenyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 2791333 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[2-(4-methoxyphenyl)quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
| SMILES | COc1ccc(-c2nc(NCCCN(C)C)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C20H24N4O.ClH/c1-24(2)14-6-13-21-20-17-7-4-5-8-18(17)22-19(23-20)15-9-11-16(25-3)12-10-15;/h4-5,7-12H,6,13-14H2,1-3H3,(H,21,22,23);1H |
| InChIKey | IXCLDPPQVWPQHR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|