C25H26N6O2S — CID 27917599
N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide (PubChem CID 27917599) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 27917599 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCC(=O)Nc3ccc(N4CCCC4)cc3C)nnc12 |
| InChI | InChI=1S/C25H26N6O2S/c1-3-12-30-23(33)19-8-4-5-9-21(19)31-24(30)27-28-25(31)34-16-22(32)26-20-11-10-18(15-17(20)2)29-13-6-7-14-29/h3-5,8-11,15H,1,6-7,12-14,16H2,2H3,(H,26,32) |
| InChIKey | BTPGAGWJSBZALI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|