C22H27N5O4S2 — CID 27917837
2-[[4-cyclopentyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide (PubChem CID 27917837) has the molecular formula C22H27N5O4S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[[4-cyclopentyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[4-cyclopentyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 27917837 |
| Molecular Formula | C22H27N5O4S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[[4-cyclopentyl-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1nnc(-c2cccc(S(=O)(=O)N3CCOCC3)c2)n1C1CCCC1 |
| InChI | InChI=1S/C22H27N5O4S2/c1-2-10-23-20(28)16-32-22-25-24-21(27(22)18-7-3-4-8-18)17-6-5-9-19(15-17)33(29,30)26-11-13-31-14-12-26/h1,5-6,9,15,18H,3-4,7-8,10-14,16H2,(H,23,28) |
| InChIKey | JDFJESYWMFKPBS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|