C19H27N5OS2 — CID 27918639
2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 27918639) has the molecular formula C19H27N5OS2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 27918639 |
| Molecular Formula | C19H27N5OS2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)CSc2nnc(NC3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C19H27N5OS2/c1-24(2)16-10-8-14(9-11-16)12-20-17(25)13-26-19-23-22-18(27-19)21-15-6-4-3-5-7-15/h8-11,15H,3-7,12-13H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | VHCIZXQHZKBSSK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|