About diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate
diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate (PubChem CID 2791878) has the molecular formula C22H29N3O5
and a molecular weight of 415.49 g/mol. Its IUPAC name is diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate |
| PubChem CID | 2791878 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2ncc(C(=O)OCC)c(NCCCN3CCOCC3)c2c1 |
| InChI | InChI=1S/C22H29N3O5/c1-3-29-21(26)16-6-7-19-17(14-16)20(18(15-24-19)22(27)30-4-2)23-8-5-9-25-10-12-28-13-11-25/h6-7,14-15H,3-5,8-13H2,1-2H3,(H,23,24) |
| InChIKey | BJJUFVHGCKETRY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate?
The IUPAC name of diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate (CID 2791878) is diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate.
What is the SMILES notation for diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate?
The canonical SMILES for diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate is CCOC(=O)c1ccc2ncc(C(=O)OCC)c(NCCCN3CCOCC3)c2c1.
What is the InChIKey of diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate?
The InChIKey is BJJUFVHGCKETRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O5/c1-3-29-21(26)16-6-7-19-17(14-16)20(18(15-24-19)22(27)30-4-2)23-8-5-9-25-10-12-28-13-11-25/h6-7,14-15H,3-5,8-13H2,1-2H3,(H,23,24).
What are the key properties of diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate?
diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate has a molecular weight of 415.49 g/mol, XLogP of 2.72, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-(3-morpholin-4-ylpropylamino)quinoline-3,6-dicarboxylate is sourced from PubChem (CID 2791878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).