C19H20ClNO2 — CID 2792142
3-(4-butoxyphenyl)-N-(2-chlorophenyl)prop-2-enamide (PubChem CID 2792142) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-N-(2-chlorophenyl)prop-2-enamide.
| Compound Name | 3-(4-butoxyphenyl)-N-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2792142 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(4-butoxyphenyl)-N-(2-chlorophenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(C=CC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO2/c1-2-3-14-23-16-11-8-15(9-12-16)10-13-19(22)21-18-7-5-4-6-17(18)20/h4-13H,2-3,14H2,1H3,(H,21,22) |
| InChIKey | OMXBERNCHAZIMF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|