About 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride
4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride (PubChem CID 2792371) has the molecular formula C18H14ClN3OS
and a molecular weight of 355.85 g/mol. Its IUPAC name is 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride |
| PubChem CID | 2792371 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C18H13N3OS.ClH/c22-14-8-6-13(7-9-14)21-17-16-15(12-4-2-1-3-5-12)10-23-18(16)20-11-19-17;/h1-11,22H,(H,19,20,21);1H |
| InChIKey | OLGHHEMGDBCXCK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride?
The IUPAC name of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride (CID 2792371) is 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride.
What is the SMILES notation for 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride?
The canonical SMILES for 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride is Cl.Oc1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1.
What is the InChIKey of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride?
The InChIKey is OLGHHEMGDBCXCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3OS.ClH/c22-14-8-6-13(7-9-14)21-17-16-15(12-4-2-1-3-5-12)10-23-18(16)20-11-19-17;/h1-11,22H,(H,19,20,21);1H.
What are the key properties of 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride?
4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride has a molecular weight of 355.85 g/mol, XLogP of 5.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenol;hydrochloride is sourced from PubChem (CID 2792371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).