C7H12N4O2 — CID 279241
7-methyl-4a,5,6,7,8,8a-hexahydro-1H-pteridine-2,4-dione (PubChem CID 279241) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 7-methyl-4a,5,6,7,8,8a-hexahydro-1H-pteridine-2,4-dione.
| Compound Name | 7-methyl-4a,5,6,7,8,8a-hexahydro-1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 279241 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 7-methyl-4a,5,6,7,8,8a-hexahydro-1H-pteridine-2,4-dione |
| SMILES | CC1CNC2C(N1)NC(=O)NC2=O |
| InChI | InChI=1S/C7H12N4O2/c1-3-2-8-4-5(9-3)10-7(13)11-6(4)12/h3-5,8-9H,2H2,1H3,(H2,10,11,12,13) |
| InChIKey | XYLXQPWBEAJZGS-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 255 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |