C27H27N3O6 — CID 27926089
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 27926089) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27926089 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H27N3O6/c1-34-21-14-18(15-22(35-2)24(21)36-3)16-28-23(31)17-30-25(32)27(29-26(30)33,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,16-17H2,1-3H3,(H,28,31)(H,29,33) |
| InChIKey | WIABGRDVOBDKBC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|