C21H26ClN5O2 — CID 2792715
N',N'-diethyl-N-[2-(4-nitrophenyl)quinazolin-4-yl]propane-1,3-diamine;hydrochloride (PubChem CID 2792715) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-(4-nitrophenyl)quinazolin-4-yl]propane-1,3-diamine;hydrochloride.
| Compound Name | N',N'-diethyl-N-[2-(4-nitrophenyl)quinazolin-4-yl]propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 2792715 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N',N'-diethyl-N-[2-(4-nitrophenyl)quinazolin-4-yl]propane-1,3-diamine;hydrochloride |
| SMILES | CCN(CC)CCCNc1nc(-c2ccc([N+](=O)[O-])cc2)nc2ccccc12.Cl |
| InChI | InChI=1S/C21H25N5O2.ClH/c1-3-25(4-2)15-7-14-22-21-18-8-5-6-9-19(18)23-20(24-21)16-10-12-17(13-11-16)26(27)28;/h5-6,8-13H,3-4,7,14-15H2,1-2H3,(H,22,23,24);1H |
| InChIKey | JAOZKQGPPLDQDA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|