C23H28N2O7 — CID 27928826
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate (PubChem CID 27928826) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 27928826 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)CNC(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O7/c1-3-29-18-7-5-17(6-8-18)23(28)25-15-22(27)32-16-21(26)24-13-14-31-20-11-9-19(10-12-20)30-4-2/h5-12H,3-4,13-16H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | AYAYTKZFBKRPRL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|