C16H12N2O5 — CID 2793722
8-methoxy-3-nitro-3-phenyl-1H-quinoline-2,4-dione (PubChem CID 2793722) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 8-methoxy-3-nitro-3-phenyl-1H-quinoline-2,4-dione.
| Compound Name | 8-methoxy-3-nitro-3-phenyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 2793722 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 8-methoxy-3-nitro-3-phenyl-1H-quinoline-2,4-dione |
| SMILES | COc1cccc2c1NC(=O)C(c1ccccc1)([N+](=O)[O-])C2=O |
| InChI | InChI=1S/C16H12N2O5/c1-23-12-9-5-8-11-13(12)17-15(20)16(14(11)19,18(21)22)10-6-3-2-4-7-10/h2-9H,1H3,(H,17,20) |
| InChIKey | IGTDQQPPNHMNHX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|