About 3-(benzylamino)propane-1,2-diol
3-(benzylamino)propane-1,2-diol (PubChem CID 2793828) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(benzylamino)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(benzylamino)propane-1,2-diol |
| PubChem CID | 2793828 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-(benzylamino)propane-1,2-diol |
| SMILES | OCC(O)CNCc1ccccc1 |
| InChI | InChI=1S/C10H15NO2/c12-8-10(13)7-11-6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2 |
| InChIKey | CGBQPTYOFPMKAL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzylamino)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)propane-1,2-diol?
The IUPAC name of 3-(benzylamino)propane-1,2-diol (CID 2793828) is 3-(benzylamino)propane-1,2-diol.
What is the SMILES notation for 3-(benzylamino)propane-1,2-diol?
The canonical SMILES for 3-(benzylamino)propane-1,2-diol is OCC(O)CNCc1ccccc1.
What is the InChIKey of 3-(benzylamino)propane-1,2-diol?
The InChIKey is CGBQPTYOFPMKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c12-8-10(13)7-11-6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2.
What are the key properties of 3-(benzylamino)propane-1,2-diol?
3-(benzylamino)propane-1,2-diol has a molecular weight of 181.24 g/mol, XLogP of 0.13, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)propane-1,2-diol is sourced from PubChem (CID 2793828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).