About 1-ethylbenzotriazole
1-ethylbenzotriazole (PubChem CID 27939) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-ethylbenzotriazole.
Molecular Properties
| Compound Name | 1-ethylbenzotriazole |
| PubChem CID | 27939 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1-ethylbenzotriazole |
| SMILES | CCn1nnc2ccccc21 |
| InChI | InChI=1S/C8H9N3/c1-2-11-8-6-4-3-5-7(8)9-10-11/h3-6H,2H2,1H3 |
| InChIKey | VGCWCUQMEWJQSU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylbenzotriazole?
The IUPAC name of 1-ethylbenzotriazole (CID 27939) is 1-ethylbenzotriazole.
What is the SMILES notation for 1-ethylbenzotriazole?
The canonical SMILES for 1-ethylbenzotriazole is CCn1nnc2ccccc21.
What is the InChIKey of 1-ethylbenzotriazole?
The InChIKey is VGCWCUQMEWJQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-2-11-8-6-4-3-5-7(8)9-10-11/h3-6H,2H2,1H3.
What are the key properties of 1-ethylbenzotriazole?
1-ethylbenzotriazole has a molecular weight of 147.18 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylbenzotriazole is sourced from PubChem (CID 27939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).