About 2-azido-1-phenylethanol
2-azido-1-phenylethanol (PubChem CID 2793925) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-azido-1-phenylethanol.
Molecular Properties
| Compound Name | 2-azido-1-phenylethanol |
| PubChem CID | 2793925 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-azido-1-phenylethanol |
| SMILES | [N-]=[N+]=NCC(O)c1ccccc1 |
| InChI | InChI=1S/C8H9N3O/c9-11-10-6-8(12)7-4-2-1-3-5-7/h1-5,8,12H,6H2 |
| InChIKey | MALKRPRQNKEVSK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1-phenylethanol?
The IUPAC name of 2-azido-1-phenylethanol (CID 2793925) is 2-azido-1-phenylethanol.
What is the SMILES notation for 2-azido-1-phenylethanol?
The canonical SMILES for 2-azido-1-phenylethanol is [N-]=[N+]=NCC(O)c1ccccc1.
What is the InChIKey of 2-azido-1-phenylethanol?
The InChIKey is MALKRPRQNKEVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-11-10-6-8(12)7-4-2-1-3-5-7/h1-5,8,12H,6H2.
What are the key properties of 2-azido-1-phenylethanol?
2-azido-1-phenylethanol has a molecular weight of 163.18 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1-phenylethanol is sourced from PubChem (CID 2793925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).