About butyl 4-tert-butylbenzoate
butyl 4-tert-butylbenzoate (PubChem CID 2794169) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is butyl 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | butyl 4-tert-butylbenzoate |
| PubChem CID | 2794169 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | butyl 4-tert-butylbenzoate |
| SMILES | CCCCOC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22O2/c1-5-6-11-17-14(16)12-7-9-13(10-8-12)15(2,3)4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | BMSNGGLCKZGIEY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-tert-butylbenzoate?
The IUPAC name of butyl 4-tert-butylbenzoate (CID 2794169) is butyl 4-tert-butylbenzoate.
What is the SMILES notation for butyl 4-tert-butylbenzoate?
The canonical SMILES for butyl 4-tert-butylbenzoate is CCCCOC(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of butyl 4-tert-butylbenzoate?
The InChIKey is BMSNGGLCKZGIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-5-6-11-17-14(16)12-7-9-13(10-8-12)15(2,3)4/h7-10H,5-6,11H2,1-4H3.
What are the key properties of butyl 4-tert-butylbenzoate?
butyl 4-tert-butylbenzoate has a molecular weight of 234.34 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-tert-butylbenzoate is sourced from PubChem (CID 2794169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).