About 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine
3,5-bis(chloromethyl)-1,2,4-triazol-4-amine (PubChem CID 2794180) has the molecular formula C4H6Cl2N4
and a molecular weight of 181.03 g/mol. Its IUPAC name is 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine |
| PubChem CID | 2794180 |
| Molecular Formula | C4H6Cl2N4 |
| Molecular Weight | 181.03 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(CCl)nnc1CCl |
| InChI | InChI=1S/C4H6Cl2N4/c5-1-3-8-9-4(2-6)10(3)7/h1-2,7H2 |
| InChIKey | YWYBYSYWJPGLGZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.03 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine (CID 2794180) is 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine is Nn1c(CCl)nnc1CCl.
What is the InChIKey of 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine?
The InChIKey is YWYBYSYWJPGLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl2N4/c5-1-3-8-9-4(2-6)10(3)7/h1-2,7H2.
What are the key properties of 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine?
3,5-bis(chloromethyl)-1,2,4-triazol-4-amine has a molecular weight of 181.03 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(chloromethyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 2794180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).