About 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine
1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine (PubChem CID 2794255) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine |
| PubChem CID | 2794255 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C15H27N/c1-13-5-12-6-14(2,8-13)10-15(7-12,9-13)11-16(3)4/h12H,5-11H2,1-4H3 |
| InChIKey | XNDWVIUNZZRFLG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine (CID 2794255) is 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine is CN(C)CC12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine?
The InChIKey is XNDWVIUNZZRFLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-13-5-12-6-14(2,8-13)10-15(7-12,9-13)11-16(3)4/h12H,5-11H2,1-4H3.
What are the key properties of 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine?
1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine has a molecular weight of 221.39 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-1-adamantyl)-N,N-dimethylmethanamine is sourced from PubChem (CID 2794255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).