C12H10F3NO3 — CID 2794452
6,8-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 2794452) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is 6,8-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6,8-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2794452 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 6,8-dimethoxy-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | COc1cc(OC)c2[nH]c(=O)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H10F3NO3/c1-18-6-3-7-8(12(13,14)15)5-10(17)16-11(7)9(4-6)19-2/h3-5H,1-2H3,(H,16,17) |
| InChIKey | FPMOEIQPXJUCKR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |