About (2,5-dioxopyrrolidin-1-yl) undec-10-enoate
(2,5-dioxopyrrolidin-1-yl) undec-10-enoate (PubChem CID 2794467) has the molecular formula C15H23NO4
and a molecular weight of 281.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) undec-10-enoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) undec-10-enoate |
| PubChem CID | 2794467 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H23NO4/c1-2-3-4-5-6-7-8-9-10-15(19)20-16-13(17)11-12-14(16)18/h2H,1,3-12H2 |
| InChIKey | OGMHSLIKBSLUAR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) undec-10-enoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) undec-10-enoate (CID 2794467) is (2,5-dioxopyrrolidin-1-yl) undec-10-enoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) undec-10-enoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) undec-10-enoate is C=CCCCCCCCCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) undec-10-enoate?
The InChIKey is OGMHSLIKBSLUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4/c1-2-3-4-5-6-7-8-9-10-15(19)20-16-13(17)11-12-14(16)18/h2H,1,3-12H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) undec-10-enoate?
(2,5-dioxopyrrolidin-1-yl) undec-10-enoate has a molecular weight of 281.35 g/mol, XLogP of 2.90, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) undec-10-enoate is sourced from PubChem (CID 2794467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).