6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid

C7H4ClN3O2 — CID 2794637

IUPAC6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid
SMILESO=C(O)c1cn2nc(Cl)ccc2n1
InChIInChI=1S/C7H4ClN3O2/c8-5-1-2-6-9-4(7(12)13)3-11(6)10-5/h1-3H,(H,12,13)
InChIKeyHTUZJYQXKFDVLT-UHFFFAOYSA-N
MW197.58 g/mol
LogP1.08
Rot. Bonds1

About 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid

6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid (PubChem CID 2794637) has the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. Its IUPAC name is 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid.

Molecular Properties

Compound Name6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid
PubChem CID2794637
Molecular FormulaC7H4ClN3O2
Molecular Weight197.58 g/mol
Exact Mass197.00
IUPAC Name6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid
SMILESO=C(O)c1cn2nc(Cl)ccc2n1
InChIInChI=1S/C7H4ClN3O2/c8-5-1-2-6-9-4(7(12)13)3-11(6)10-5/h1-3H,(H,12,13)
InChIKeyHTUZJYQXKFDVLT-UHFFFAOYSA-N
XLogP1.08
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.58
LogP ≤ 51.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid?
The IUPAC name of 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid (CID 2794637) is 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid.
What is the SMILES notation for 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid?
The canonical SMILES for 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid is O=C(O)c1cn2nc(Cl)ccc2n1.
What is the InChIKey of 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid?
The InChIKey is HTUZJYQXKFDVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O2/c8-5-1-2-6-9-4(7(12)13)3-11(6)10-5/h1-3H,(H,12,13).
What are the key properties of 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid?
6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid has a molecular weight of 197.58 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloroimidazo[1,2-b]pyridazine-2-carboxylic acid is sourced from PubChem (CID 2794637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).