4-(2-chlorophenoxy)benzenesulfonyl chloride

C12H8Cl2O3S — CID 2794710

IUPAC4-(2-chlorophenoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Oc2ccccc2Cl)cc1
InChIInChI=1S/C12H8Cl2O3S/c13-11-3-1-2-4-12(11)17-9-5-7-10(8-6-9)18(14,15)16/h1-8H
InChIKeyILZBGLOVCXTRDS-UHFFFAOYSA-N
MW303.17 g/mol
LogP4.06
Rot. Bonds3

About 4-(2-chlorophenoxy)benzenesulfonyl chloride

4-(2-chlorophenoxy)benzenesulfonyl chloride (PubChem CID 2794710) has the molecular formula C12H8Cl2O3S and a molecular weight of 303.17 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2-chlorophenoxy)benzenesulfonyl chloride
PubChem CID2794710
Molecular FormulaC12H8Cl2O3S
Molecular Weight303.17 g/mol
Exact Mass301.96
IUPAC Name4-(2-chlorophenoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Oc2ccccc2Cl)cc1
InChIInChI=1S/C12H8Cl2O3S/c13-11-3-1-2-4-12(11)17-9-5-7-10(8-6-9)18(14,15)16/h1-8H
InChIKeyILZBGLOVCXTRDS-UHFFFAOYSA-N
XLogP4.06
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.17
LogP ≤ 54.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(2-chlorophenoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Bis(4-chlorosulfonylphenyl) ether
CID 8484
2-Chloro-1-(3-chloro-5-fluorophenoxy)-4-(trifluoromethylsulfonyl)benzene
CID 117943030
Benzene, 1-chloro-4-(4-(methylsulfonyl)phenoxy)-
CID 514875
2,4'-Dichlorodiphenyl ether
CID 23341
2-Chlorodiphenyl ether
CID 75900
4-Phenoxybenzene-1-sulfonyl chloride
CID 2794756
4-(3,4-dichlorophenoxy)benzenesulfonyl Chloride
CID 3694483
4-(3-Chloro-4-fluorophenoxy)benzene-1-sulfonamide
CID 43342694
Benzene, 1-chloro-2-(4-(methylsulfonyl)phenoxy)-
CID 514884
2,6-Dichlorodiphenyl ether
CID 119954
1,4-Bis-(2-chlorophenoxy)-2-butene
CID 6158264
4-(4-Chlorophenoxy)benzene-1-sulfonyl chloride
CID 2757750

Frequently Asked Questions

What is the IUPAC name of 4-(2-chlorophenoxy)benzenesulfonyl chloride?
The IUPAC name of 4-(2-chlorophenoxy)benzenesulfonyl chloride (CID 2794710) is 4-(2-chlorophenoxy)benzenesulfonyl chloride.
What is the SMILES notation for 4-(2-chlorophenoxy)benzenesulfonyl chloride?
The canonical SMILES for 4-(2-chlorophenoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(Oc2ccccc2Cl)cc1.
What is the InChIKey of 4-(2-chlorophenoxy)benzenesulfonyl chloride?
The InChIKey is ILZBGLOVCXTRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2O3S/c13-11-3-1-2-4-12(11)17-9-5-7-10(8-6-9)18(14,15)16/h1-8H.
What are the key properties of 4-(2-chlorophenoxy)benzenesulfonyl chloride?
4-(2-chlorophenoxy)benzenesulfonyl chloride has a molecular weight of 303.17 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenoxy)benzenesulfonyl chloride is sourced from PubChem (CID 2794710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).